Survey Maker Survey Templates Contact Privacy & Security

Structural Formula

A colorful infographic illustrating chemical structures and molecular formulas, featuring 3D models, skeletal structures, and representations of statins like Simvastatin, with a chalkboard background.

Understanding Structural Formulas Quiz

Explore the fascinating world of chemistry with our interactive quiz on structural formulas! This quiz tests your knowledge on different structural representations, including condensed and skeletal structures, and challenges you to identify key characteristics of various molecules.

Key Features:

10 multiple-choice questions
Immediate feedback on answers
Great for chemistry enthusiasts and students

10 Questions2 MinutesCreated by AnalyzingAtom42

1. Based on the diagram, the 1-decene molecule is represented in

3d structure

Condensed structure

Expanded structure

Skeletal structure

2. The hydrogen atoms are invisible in the

Skeletal structure

Condensed structure

Expanded structure

3. Convert the above formula into its condensed structure

CH3CH2CH2CH2CH2CH2CH3

CH3(CH2)4CH3

CH3(CH2)=CHCH3

CH3CH2CH2CH2CH3

4. Simvastatin belongs to a group of medicine called statins. Based on this diagram, there are _______ structural formulas shown.

5. The circled hydrogen atom is

Tertiary hydrogen

Secondary hydrogen

Primary hydrogen

Quarternary hydrogen

6. The circled carbon atom is...

Primary carbon

Secondary carbon

Tertiary carbon

Quarternary carbon

7. An allene is a compound in which one carbon atom has double bonds with each of its two adjacent carbon centres. The wedged bond indicates that

The bond is behind the plane of the page

The bond lies in the plane of the page

The bond is likely to break

The bond protrudes towards the viewer

8. Determine the correct structure for the formula above

CH3CH(CH3)2CH=(CH2)2CH3

9. Which of the following is the correct condensed representation of the structure above?

CH3CH2HC(CH2CH3)(CH2)4CH3

CH3CH2CH(CH2CH3)CH(CH2CH3)(CH2)3CH3

CH3(CH2)6CH3

CH3CH2CH(CH2CH3)CH(CH2CH3)(CH2)4CH3

10. The skeletal diagram was first used by chemist

Michael Faraday

Friedrich August Kekulé von Stradonitz

Alfred Nobel

Antoine Lavoisier

{"name":"Structural Formula", "url":"https://www.quiz-maker.com/QPREVIEW","txt":"Explore the fascinating world of chemistry with our interactive quiz on structural formulas! This quiz tests your knowledge on different structural representations, including condensed and skeletal structures, and challenges you to identify key characteristics of various molecules.Key Features:10 multiple-choice questionsImmediate feedback on answersGreat for chemistry enthusiasts and students","img":"https:/images/course2.png"}